C18H14FNO4 — CID 31981087
3-(1,3-dioxoisoindol-2-yl)propyl 4-fluorobenzoate (PubChem CID 31981087) has the molecular formula C18H14FNO4 and a molecular weight of 327.31 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 4-fluorobenzoate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 31981087 |
| Molecular Formula | C18H14FNO4 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-fluorobenzoate |
| SMILES | O=C(OCCCN1C(=O)c2ccccc2C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FNO4/c19-13-8-6-12(7-9-13)18(23)24-11-3-10-20-16(21)14-4-1-2-5-15(14)17(20)22/h1-2,4-9H,3,10-11H2 |
| InChIKey | OIJCDJPGQMTOSM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|