C20H16FNO5 — CID 9363316
[2-(4-fluorophenyl)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 9363316) has the molecular formula C20H16FNO5 and a molecular weight of 369.35 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 9363316 |
| Molecular Formula | C20H16FNO5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FNO5/c21-14-9-7-13(8-10-14)17(23)12-27-18(24)6-3-11-22-19(25)15-4-1-2-5-16(15)20(22)26/h1-2,4-5,7-10H,3,6,11-12H2 |
| InChIKey | KQBUUGGCKGQVKE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|