C25H18FNO5 — CID 40988751
[2-(4-fluorophenyl)-2-oxoethyl] 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylate (PubChem CID 40988751) has the molecular formula C25H18FNO5 and a molecular weight of 431.42 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 40988751 |
| Molecular Formula | C25H18FNO5 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H18FNO5/c26-19-9-6-17(7-10-19)22(28)15-32-25(31)18-8-11-20-21(14-18)24(30)27(23(20)29)13-12-16-4-2-1-3-5-16/h1-11,14H,12-13,15H2 |
| InChIKey | PDEFMUAIUUKNFK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|