C26H19F3N2O5 — CID 1188298
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylate (PubChem CID 1188298) has the molecular formula C26H19F3N2O5 and a molecular weight of 496.44 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 1188298 |
| Molecular Formula | C26H19F3N2O5 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H19F3N2O5/c27-26(28,29)20-8-4-5-9-21(20)30-22(32)15-36-25(35)17-10-11-18-19(14-17)24(34)31(23(18)33)13-12-16-6-2-1-3-7-16/h1-11,14H,12-13,15H2,(H,30,32) |
| InChIKey | HYEWEDYHOLZNPY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|