C25H21N3O5 — CID 108755465
ethyl 2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]pyridine-4-carboxylate (PubChem CID 108755465) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is ethyl 2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 108755465 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | ethyl 2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(NC(=O)c2ccc3c(c2)C(=O)N(CCc2ccccc2)C3=O)c1 |
| InChI | InChI=1S/C25H21N3O5/c1-2-33-25(32)18-10-12-26-21(15-18)27-22(29)17-8-9-19-20(14-17)24(31)28(23(19)30)13-11-16-6-4-3-5-7-16/h3-10,12,14-15H,2,11,13H2,1H3,(H,26,27,29) |
| InChIKey | JDVOPNCKTKLCHR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|