C24H26N2O6 — CID 71895374
ethyl 2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]-(2-methoxyethyl)amino]acetate (PubChem CID 71895374) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is ethyl 2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 71895374 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | ethyl 2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O |
| InChI | InChI=1S/C24H26N2O6/c1-3-32-21(27)16-25(13-14-31-2)22(28)18-9-10-19-20(15-18)24(30)26(23(19)29)12-11-17-7-5-4-6-8-17/h4-10,15H,3,11-14,16H2,1-2H3 |
| InChIKey | VVJARGNMZMBAHT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|