C28H28N2O5 — CID 26826321
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide (PubChem CID 26826321) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 26826321 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxamide |
| SMILES | COc1ccc(CCN(C)C(=O)c2ccc3c(c2)C(=O)N(CCc2ccccc2)C3=O)cc1OC |
| InChI | InChI=1S/C28H28N2O5/c1-29(15-13-20-9-12-24(34-2)25(17-20)35-3)26(31)21-10-11-22-23(18-21)28(33)30(27(22)32)16-14-19-7-5-4-6-8-19/h4-12,17-18H,13-16H2,1-3H3 |
| InChIKey | GRQXUHGDVPJHHU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|