C25H21IN2O5 — CID 17171639
2-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-iodophenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17171639) has the molecular formula C25H21IN2O5 and a molecular weight of 556.36 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-iodophenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-iodophenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17171639 |
| Molecular Formula | C25H21IN2O5 |
| Molecular Weight | 556.36 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-iodophenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1ccc(CCN2C(=O)c3ccc(C(=O)Nc4cccc(I)c4)cc3C2=O)cc1OC |
| InChI | InChI=1S/C25H21IN2O5/c1-32-21-9-6-15(12-22(21)33-2)10-11-28-24(30)19-8-7-16(13-20(19)25(28)31)23(29)27-18-5-3-4-17(26)14-18/h3-9,12-14H,10-11H2,1-2H3,(H,27,29) |
| InChIKey | VXWRLNKYKLOIBD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|