C19H16N2O6 — CID 2216673
3-[[2-(2-methoxyethyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 2216673) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is 3-[[2-(2-methoxyethyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[2-(2-methoxyethyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2216673 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-[[2-(2-methoxyethyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | COCCN1C(=O)c2ccc(C(=O)Nc3cccc(C(=O)O)c3)cc2C1=O |
| InChI | InChI=1S/C19H16N2O6/c1-27-8-7-21-17(23)14-6-5-11(10-15(14)18(21)24)16(22)20-13-4-2-3-12(9-13)19(25)26/h2-6,9-10H,7-8H2,1H3,(H,20,22)(H,25,26) |
| InChIKey | LLKSJRZNAZATOA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|