C25H22N4O5 — CID 108925012
2-(3-methoxypropyl)-1,3-dioxo-N-[4-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide (PubChem CID 108925012) has the molecular formula C25H22N4O5 and a molecular weight of 458.47 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-1,3-dioxo-N-[4-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide.
| Compound Name | 2-(3-methoxypropyl)-1,3-dioxo-N-[4-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108925012 |
| Molecular Formula | C25H22N4O5 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-(3-methoxypropyl)-1,3-dioxo-N-[4-(pyridine-3-carbonylamino)phenyl]isoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3ccc(NC(=O)c4cccnc4)cc3)cc2C1=O |
| InChI | InChI=1S/C25H22N4O5/c1-34-13-3-12-29-24(32)20-10-5-16(14-21(20)25(29)33)22(30)27-18-6-8-19(9-7-18)28-23(31)17-4-2-11-26-15-17/h2,4-11,14-15H,3,12-13H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | QMUMCIKCWGQYQT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|