C15H11N3O3 — CID 973223
2-methyl-1,3-dioxo-N-pyridin-3-ylisoindole-5-carboxamide (PubChem CID 973223) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-methyl-1,3-dioxo-N-pyridin-3-ylisoindole-5-carboxamide.
| Compound Name | 2-methyl-1,3-dioxo-N-pyridin-3-ylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 973223 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-methyl-1,3-dioxo-N-pyridin-3-ylisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)Nc3cccnc3)cc2C1=O |
| InChI | InChI=1S/C15H11N3O3/c1-18-14(20)11-5-4-9(7-12(11)15(18)21)13(19)17-10-3-2-6-16-8-10/h2-8H,1H3,(H,17,19) |
| InChIKey | NOVSPBVPEKFDFM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|