C26H24N2O5 — CID 4220387
2-(3-methoxypropyl)-N-[4-(2-methylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 4220387) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-N-[4-(2-methylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(3-methoxypropyl)-N-[4-(2-methylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 4220387 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-(3-methoxypropyl)-N-[4-(2-methylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3ccc(Oc4ccccc4C)cc3)cc2C1=O |
| InChI | InChI=1S/C26H24N2O5/c1-17-6-3-4-7-23(17)33-20-11-9-19(10-12-20)27-24(29)18-8-13-21-22(16-18)26(31)28(25(21)30)14-5-15-32-2/h3-4,6-13,16H,5,14-15H2,1-2H3,(H,27,29) |
| InChIKey | VBJJECMMQADKCQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|