C20H21N3O5 — CID 108873532
1-(2-methoxyphenyl)-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea (PubChem CID 108873532) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea |
|---|---|
| PubChem CID | 108873532 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea |
| SMILES | COCCCN1C(=O)c2ccc(NC(=O)Nc3ccccc3OC)cc2C1=O |
| InChI | InChI=1S/C20H21N3O5/c1-27-11-5-10-23-18(24)14-9-8-13(12-15(14)19(23)25)21-20(26)22-16-6-3-4-7-17(16)28-2/h3-4,6-9,12H,5,10-11H2,1-2H3,(H2,21,22,26) |
| InChIKey | LFYHHCDVSAGNFS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|