C20H18N4O4 — CID 108873547
1-(2-cyanophenyl)-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea (PubChem CID 108873547) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea.
| Compound Name | 1-(2-cyanophenyl)-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea |
|---|---|
| PubChem CID | 108873547 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-(2-cyanophenyl)-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea |
| SMILES | COCCCN1C(=O)c2ccc(NC(=O)Nc3ccccc3C#N)cc2C1=O |
| InChI | InChI=1S/C20H18N4O4/c1-28-10-4-9-24-18(25)15-8-7-14(11-16(15)19(24)26)22-20(27)23-17-6-3-2-5-13(17)12-21/h2-3,5-8,11H,4,9-10H2,1H3,(H2,22,23,27) |
| InChIKey | KUSBMJXEEVXLKD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|