C16H19N3O6 — CID 108873596
2-[[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]carbamoylamino]propanoic acid (PubChem CID 108873596) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is 2-[[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]carbamoylamino]propanoic acid.
| Compound Name | 2-[[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 108873596 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]carbamoylamino]propanoic acid |
| SMILES | COCCCN1C(=O)c2ccc(NC(=O)NC(C)C(=O)O)cc2C1=O |
| InChI | InChI=1S/C16H19N3O6/c1-9(15(22)23)17-16(24)18-10-4-5-11-12(8-10)14(21)19(13(11)20)6-3-7-25-2/h4-5,8-9H,3,6-7H2,1-2H3,(H,22,23)(H2,17,18,24) |
| InChIKey | WFBOQCYXAUATTI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|