C20H27N3O4 — CID 108873703
N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-2,6-dimethylpiperidine-1-carboxamide (PubChem CID 108873703) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-2,6-dimethylpiperidine-1-carboxamide.
| Compound Name | N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-2,6-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 108873703 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-2,6-dimethylpiperidine-1-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(NC(=O)N3C(C)CCCC3C)cc2C1=O |
| InChI | InChI=1S/C20H27N3O4/c1-13-6-4-7-14(2)23(13)20(26)21-15-8-9-16-17(12-15)19(25)22(18(16)24)10-5-11-27-3/h8-9,12-14H,4-7,10-11H2,1-3H3,(H,21,26) |
| InChIKey | JXBUGRYPGBQDDT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|