C19H24N4O5 — CID 108873799
1-N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]piperidine-1,4-dicarboxamide (PubChem CID 108873799) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 108873799 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]piperidine-1,4-dicarboxamide |
| SMILES | COCCCN1C(=O)c2ccc(NC(=O)N3CCC(C(N)=O)CC3)cc2C1=O |
| InChI | InChI=1S/C19H24N4O5/c1-28-10-2-7-23-17(25)14-4-3-13(11-15(14)18(23)26)21-19(27)22-8-5-12(6-9-22)16(20)24/h3-4,11-12H,2,5-10H2,1H3,(H2,20,24)(H,21,27) |
| InChIKey | KHIXKDLVPLZYSR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|