C22H23N3O4 — CID 108873784
N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-2-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 108873784) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-2-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-2-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 108873784 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-2-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(NC(=O)N3c4ccccc4CC3C)cc2C1=O |
| InChI | InChI=1S/C22H23N3O4/c1-14-12-15-6-3-4-7-19(15)25(14)22(28)23-16-8-9-17-18(13-16)21(27)24(20(17)26)10-5-11-29-2/h3-4,6-9,13-14H,5,10-12H2,1-2H3,(H,23,28) |
| InChIKey | YSNDVQLHIRVUGD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|