C21H20BrN3O3 — CID 108889946
N-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-2-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 108889946) has the molecular formula C21H20BrN3O3 and a molecular weight of 442.31 g/mol. Its IUPAC name is N-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-2-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-2-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 108889946 |
| Molecular Formula | C21H20BrN3O3 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | N-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-2-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CC1Cc2ccccc2N1C(=O)NCCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C21H20BrN3O3/c1-13-11-14-5-2-3-6-18(14)25(13)21(28)23-9-4-10-24-19(26)16-8-7-15(22)12-17(16)20(24)27/h2-3,5-8,12-13H,4,9-11H2,1H3,(H,23,28) |
| InChIKey | YUMNECADNYLNGP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|