C17H23BrN4O3 — CID 108889864
1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[3-(dimethylamino)propyl]urea (PubChem CID 108889864) has the molecular formula C17H23BrN4O3 and a molecular weight of 411.30 g/mol. Its IUPAC name is 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[3-(dimethylamino)propyl]urea.
| Compound Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[3-(dimethylamino)propyl]urea |
|---|---|
| PubChem CID | 108889864 |
| Molecular Formula | C17H23BrN4O3 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[3-(dimethylamino)propyl]urea |
| SMILES | CN(C)CCCNC(=O)NCCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C17H23BrN4O3/c1-21(2)9-3-7-19-17(25)20-8-4-10-22-15(23)13-6-5-12(18)11-14(13)16(22)24/h5-6,11H,3-4,7-10H2,1-2H3,(H2,19,20,25) |
| InChIKey | FVLCCXLCPVQVME-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|