C19H27BrN4O3 — CID 108889863
1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[3-(diethylamino)propyl]urea (PubChem CID 108889863) has the molecular formula C19H27BrN4O3 and a molecular weight of 439.35 g/mol. Its IUPAC name is 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[3-(diethylamino)propyl]urea.
| Compound Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[3-(diethylamino)propyl]urea |
|---|---|
| PubChem CID | 108889863 |
| Molecular Formula | C19H27BrN4O3 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[3-(diethylamino)propyl]urea |
| SMILES | CCN(CC)CCCNC(=O)NCCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C19H27BrN4O3/c1-3-23(4-2)11-5-9-21-19(27)22-10-6-12-24-17(25)15-8-7-14(20)13-16(15)18(24)26/h7-8,13H,3-6,9-12H2,1-2H3,(H2,21,22,27) |
| InChIKey | WZSHQCRHYVBAFB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|