C17H17BrN4O3S — CID 108889918
1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea (PubChem CID 108889918) has the molecular formula C17H17BrN4O3S and a molecular weight of 437.32 g/mol. Its IUPAC name is 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 108889918 |
| Molecular Formula | C17H17BrN4O3S |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-(4,5-dimethyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1nc(NC(=O)NCCCN2C(=O)c3ccc(Br)cc3C2=O)sc1C |
| InChI | InChI=1S/C17H17BrN4O3S/c1-9-10(2)26-17(20-9)21-16(25)19-6-3-7-22-14(23)12-5-4-11(18)8-13(12)15(22)24/h4-5,8H,3,6-7H2,1-2H3,(H2,19,20,21,25) |
| InChIKey | VGJCXSUPDBEZCB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|