C20H20BrN3O3 — CID 108890011
1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[(3-methylphenyl)methyl]urea (PubChem CID 108890011) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[(3-methylphenyl)methyl]urea.
| Compound Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[(3-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 108890011 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[(3-methylphenyl)methyl]urea |
| SMILES | Cc1cccc(CNC(=O)NCCCN2C(=O)c3ccc(Br)cc3C2=O)c1 |
| InChI | InChI=1S/C20H20BrN3O3/c1-13-4-2-5-14(10-13)12-23-20(27)22-8-3-9-24-18(25)16-7-6-15(21)11-17(16)19(24)26/h2,4-7,10-11H,3,8-9,12H2,1H3,(H2,22,23,27) |
| InChIKey | KJUWUOTYBYGUNY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|