C19H15BrF3N3O3 — CID 108889995
1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 108889995) has the molecular formula C19H15BrF3N3O3 and a molecular weight of 470.25 g/mol. Its IUPAC name is 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108889995 |
| Molecular Formula | C19H15BrF3N3O3 |
| Molecular Weight | 470.25 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCCN1C(=O)c2ccc(Br)cc2C1=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15BrF3N3O3/c20-12-4-7-14-15(10-12)17(28)26(16(14)27)9-1-8-24-18(29)25-13-5-2-11(3-6-13)19(21,22)23/h2-7,10H,1,8-9H2,(H2,24,25,29) |
| InChIKey | VMPOGHDGHZPJJC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|