C19H14BrClF3N3O3 — CID 108889964
1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea (PubChem CID 108889964) has the molecular formula C19H14BrClF3N3O3 and a molecular weight of 504.69 g/mol. Its IUPAC name is 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108889964 |
| Molecular Formula | C19H14BrClF3N3O3 |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | 1-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCCN1C(=O)c2ccc(Br)cc2C1=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14BrClF3N3O3/c20-10-2-4-12-13(8-10)17(29)27(16(12)28)7-1-6-25-18(30)26-15-5-3-11(21)9-14(15)19(22,23)24/h2-5,8-9H,1,6-7H2,(H2,25,26,30) |
| InChIKey | BFLMMBWQDRYZIB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|