C19H16BrClN2O3 — CID 30427994
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(4-chloro-2-methylphenyl)butanamide (PubChem CID 30427994) has the molecular formula C19H16BrClN2O3 and a molecular weight of 435.71 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(4-chloro-2-methylphenyl)butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(4-chloro-2-methylphenyl)butanamide |
|---|---|
| PubChem CID | 30427994 |
| Molecular Formula | C19H16BrClN2O3 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(4-chloro-2-methylphenyl)butanamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C19H16BrClN2O3/c1-11-9-13(21)5-7-16(11)22-17(24)3-2-8-23-18(25)14-6-4-12(20)10-15(14)19(23)26/h4-7,9-10H,2-3,8H2,1H3,(H,22,24) |
| InChIKey | BIDXHVTVSFQCJR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|