C18H12BrF3N2O3 — CID 30430903
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2,3,4-trifluorophenyl)butanamide (PubChem CID 30430903) has the molecular formula C18H12BrF3N2O3 and a molecular weight of 441.20 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2,3,4-trifluorophenyl)butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2,3,4-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 30430903 |
| Molecular Formula | C18H12BrF3N2O3 |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2,3,4-trifluorophenyl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccc(Br)cc2C1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H12BrF3N2O3/c19-9-3-4-10-11(8-9)18(27)24(17(10)26)7-1-2-14(25)23-13-6-5-12(20)15(21)16(13)22/h3-6,8H,1-2,7H2,(H,23,25) |
| InChIKey | NKZXVSUOSZZQKC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|