C18H16BrN3O3 — CID 78803344
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N'-phenylbutanehydrazide (PubChem CID 78803344) has the molecular formula C18H16BrN3O3 and a molecular weight of 402.25 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N'-phenylbutanehydrazide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N'-phenylbutanehydrazide |
|---|---|
| PubChem CID | 78803344 |
| Molecular Formula | C18H16BrN3O3 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N'-phenylbutanehydrazide |
| SMILES | O=C(CCCN1C(=O)c2ccc(Br)cc2C1=O)NNc1ccccc1 |
| InChI | InChI=1S/C18H16BrN3O3/c19-12-8-9-14-15(11-12)18(25)22(17(14)24)10-4-7-16(23)21-20-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,20H,4,7,10H2,(H,21,23) |
| InChIKey | OKDSNTBMQCSUSQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|