C21H21BrN4O5 — CID 55497012
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N'-[2-(4-methoxyanilino)acetyl]butanehydrazide (PubChem CID 55497012) has the molecular formula C21H21BrN4O5 and a molecular weight of 489.33 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N'-[2-(4-methoxyanilino)acetyl]butanehydrazide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N'-[2-(4-methoxyanilino)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 55497012 |
| Molecular Formula | C21H21BrN4O5 |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N'-[2-(4-methoxyanilino)acetyl]butanehydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)CCCN2C(=O)c3ccc(Br)cc3C2=O)cc1 |
| InChI | InChI=1S/C21H21BrN4O5/c1-31-15-7-5-14(6-8-15)23-12-19(28)25-24-18(27)3-2-10-26-20(29)16-9-4-13(22)11-17(16)21(26)30/h4-9,11,23H,2-3,10,12H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | CBMDMTFYFUHGFI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|