C21H27BrN4O6 — CID 108916233
tert-butyl N-[2-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylamino]-2-oxoethyl]carbamate (PubChem CID 108916233) has the molecular formula C21H27BrN4O6 and a molecular weight of 511.37 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916233 |
| Molecular Formula | C21H27BrN4O6 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | tert-butyl N-[2-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCNC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C21H27BrN4O6/c1-21(2,3)32-20(31)25-12-17(28)24-9-8-23-16(27)5-4-10-26-18(29)14-7-6-13(22)11-15(14)19(26)30/h6-7,11H,4-5,8-10,12H2,1-3H3,(H,23,27)(H,24,28)(H,25,31) |
| InChIKey | JGIBKYVEFUHJLK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|