C22H29BrN4O6 — CID 108919110
tert-butyl N-[3-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylamino]-3-oxopropyl]carbamate (PubChem CID 108919110) has the molecular formula C22H29BrN4O6 and a molecular weight of 525.40 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108919110 |
| Molecular Formula | C22H29BrN4O6 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | tert-butyl N-[3-[2-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]ethylamino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCCNC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C22H29BrN4O6/c1-22(2,3)33-21(32)26-9-8-18(29)25-11-10-24-17(28)5-4-12-27-19(30)15-7-6-14(23)13-16(15)20(27)31/h6-7,13H,4-5,8-12H2,1-3H3,(H,24,28)(H,25,29)(H,26,32) |
| InChIKey | GQRGLSHIFQJCKI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|