C13H13BrN2O4 — CID 33101260
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-methoxybutanamide (PubChem CID 33101260) has the molecular formula C13H13BrN2O4 and a molecular weight of 341.16 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-methoxybutanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-methoxybutanamide |
|---|---|
| PubChem CID | 33101260 |
| Molecular Formula | C13H13BrN2O4 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-methoxybutanamide |
| SMILES | CONC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C13H13BrN2O4/c1-20-15-11(17)3-2-6-16-12(18)9-5-4-8(14)7-10(9)13(16)19/h4-5,7H,2-3,6H2,1H3,(H,15,17) |
| InChIKey | LYMFVDZOMDGBEV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|