C18H15BrN2O5S — CID 26705037
methyl 3-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]thiophene-2-carboxylate (PubChem CID 26705037) has the molecular formula C18H15BrN2O5S and a molecular weight of 451.30 g/mol. Its IUPAC name is methyl 3-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 26705037 |
| Molecular Formula | C18H15BrN2O5S |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | methyl 3-[4-(5-bromo-1,3-dioxoisoindol-2-yl)butanoylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C18H15BrN2O5S/c1-26-18(25)15-13(6-8-27-15)20-14(22)3-2-7-21-16(23)11-5-4-10(19)9-12(11)17(21)24/h4-6,8-9H,2-3,7H2,1H3,(H,20,22) |
| InChIKey | HAPSCMUXSZTYPR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|