C18H16N2O5S — CID 17426187
methyl 3-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]thiophene-2-carboxylate (PubChem CID 17426187) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is methyl 3-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 17426187 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | methyl 3-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H16N2O5S/c1-25-18(24)15-13(8-10-26-15)19-14(21)7-4-9-20-16(22)11-5-2-3-6-12(11)17(20)23/h2-3,5-6,8,10H,4,7,9H2,1H3,(H,19,21) |
| InChIKey | WAAWFBJXRJQAPT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|