C22H20N2O7 — CID 2682990
dimethyl 5-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]benzene-1,3-dicarboxylate (PubChem CID 2682990) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is dimethyl 5-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2682990 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | dimethyl 5-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CCCN2C(=O)c3ccccc3C2=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H20N2O7/c1-30-21(28)13-10-14(22(29)31-2)12-15(11-13)23-18(25)8-5-9-24-19(26)16-6-3-4-7-17(16)20(24)27/h3-4,6-7,10-12H,5,8-9H2,1-2H3,(H,23,25) |
| InChIKey | DJOSZEUOWRAPHW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|