C20H18N2O4 — CID 2303121
N-(4-acetylphenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 2303121) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-(4-acetylphenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 2303121 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-(4-acetylphenyl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | CC(=O)c1ccc(NC(=O)CCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H18N2O4/c1-13(23)14-8-10-15(11-9-14)21-18(24)7-4-12-22-19(25)16-5-2-3-6-17(16)20(22)26/h2-3,5-6,8-11H,4,7,12H2,1H3,(H,21,24) |
| InChIKey | JISQMCDPVUFHKY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|