C19H20N2O3 — CID 90892974
3-(1,3-dioxoisoindol-2-yl)-N-phenylpropanamide;ethane (PubChem CID 90892974) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-phenylpropanamide;ethane.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-phenylpropanamide;ethane |
|---|---|
| PubChem CID | 90892974 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-phenylpropanamide;ethane |
| SMILES | CC.O=C(CCN1C(=O)c2ccccc2C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H14N2O3.C2H6/c20-15(18-12-6-2-1-3-7-12)10-11-19-16(21)13-8-4-5-9-14(13)17(19)22;1-2/h1-9H,10-11H2,(H,18,20);1-2H3 |
| InChIKey | QNUAGNYGMSGJCW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|