C18H13N3O3 — CID 973423
N-(4-cyanophenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 973423) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(4-cyanophenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 973423 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(4-cyanophenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | N#Cc1ccc(NC(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H13N3O3/c19-11-12-5-7-13(8-6-12)20-16(22)9-10-21-17(23)14-3-1-2-4-15(14)18(21)24/h1-8H,9-10H2,(H,20,22) |
| InChIKey | LIBUCFUCODBWOK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|