C20H16N4O4 — CID 108922697
N-[3-[(2-cyanoacetyl)amino]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 108922697) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is N-[3-[(2-cyanoacetyl)amino]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[3-[(2-cyanoacetyl)amino]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 108922697 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[3-[(2-cyanoacetyl)amino]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | N#CCC(=O)Nc1cccc(NC(=O)CCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H16N4O4/c21-10-8-17(25)22-13-4-3-5-14(12-13)23-18(26)9-11-24-19(27)15-6-1-2-7-16(15)20(24)28/h1-7,12H,8-9,11H2,(H,22,25)(H,23,26) |
| InChIKey | DZODRECMMNELQJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|