C20H15N3O5 — CID 2548735
2-(1,3-dioxoisoindol-2-yl)ethyl 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 2548735) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 2548735 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | N#CCC(=O)Nc1ccc(C(=O)OCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H15N3O5/c21-10-9-17(24)22-14-7-5-13(6-8-14)20(27)28-12-11-23-18(25)15-3-1-2-4-16(15)19(23)26/h1-8H,9,11-12H2,(H,22,24) |
| InChIKey | XWRVPAAPPAUUQX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|