C23H24N2O5 — CID 19169158
pentyl 4-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate (PubChem CID 19169158) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is pentyl 4-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate.
| Compound Name | pentyl 4-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 19169158 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | pentyl 4-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H24N2O5/c1-2-3-6-15-30-23(29)16-9-11-17(12-10-16)24-20(26)13-14-25-21(27)18-7-4-5-8-19(18)22(25)28/h4-5,7-12H,2-3,6,13-15H2,1H3,(H,24,26) |
| InChIKey | UURAYGCORKEHSD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|