C22H23N3O5 — CID 27844184
butyl 4-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]benzoate (PubChem CID 27844184) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is butyl 4-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]benzoate.
| Compound Name | butyl 4-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 27844184 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | butyl 4-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCn2[nH]c(=O)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-2-3-14-30-22(29)15-8-10-16(11-9-15)23-19(26)12-13-25-21(28)18-7-5-4-6-17(18)20(27)24-25/h4-11H,2-3,12-14H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | NAJKCPUUROKJBX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|