C18H17N3O3 — CID 40711272
2-(1,4-dioxo-3H-phthalazin-2-yl)-N-(4-ethylphenyl)acetamide (PubChem CID 40711272) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 40711272 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-2-12-7-9-13(10-8-12)19-16(22)11-21-18(24)15-6-4-3-5-14(15)17(23)20-21/h3-10H,2,11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | BSVWSLJYSZSCOK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |