C19H17N3O5 — CID 9228145
ethyl 3-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]benzoate (PubChem CID 9228145) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is ethyl 3-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9228145 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl 3-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C19H17N3O5/c1-2-27-19(26)12-6-5-7-13(10-12)20-16(23)11-22-18(25)15-9-4-3-8-14(15)17(24)21-22/h3-10H,2,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | DAOLWYXRQDGNLX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |