C23H20N4O4 — CID 17477729
2-(1,4-dioxo-3H-phthalazin-2-yl)-N-[4-(4-methoxyanilino)phenyl]acetamide (PubChem CID 17477729) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-[4-(4-methoxyanilino)phenyl]acetamide.
| Compound Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-[4-(4-methoxyanilino)phenyl]acetamide |
|---|---|
| PubChem CID | 17477729 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-[4-(4-methoxyanilino)phenyl]acetamide |
| SMILES | COc1ccc(Nc2ccc(NC(=O)Cn3[nH]c(=O)c4ccccc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C23H20N4O4/c1-31-18-12-10-16(11-13-18)24-15-6-8-17(9-7-15)25-21(28)14-27-23(30)20-5-3-2-4-19(20)22(29)26-27/h2-13,24H,14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | HDKBZAHXKNXYBW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |