C17H16N4O6S — CID 4845929
2-(1,4-dioxo-3H-phthalazin-2-yl)-N-(4-methoxy-3-sulfamoylphenyl)acetamide (PubChem CID 4845929) has the molecular formula C17H16N4O6S and a molecular weight of 404.40 g/mol. Its IUPAC name is 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-(4-methoxy-3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-(4-methoxy-3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 4845929 |
| Molecular Formula | C17H16N4O6S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-(4-methoxy-3-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H16N4O6S/c1-27-13-7-6-10(8-14(13)28(18,25)26)19-15(22)9-21-17(24)12-5-3-2-4-11(12)16(23)20-21/h2-8H,9H2,1H3,(H,19,22)(H,20,23)(H2,18,25,26) |
| InChIKey | YODQOJQIKUTRBU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |