C18H17N3O3 — CID 2083338
N-(3,5-dimethylphenyl)-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide (PubChem CID 2083338) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 2083338 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C18H17N3O3/c1-11-7-12(2)9-13(8-11)19-16(22)10-21-18(24)15-6-4-3-5-14(15)17(23)20-21/h3-9H,10H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | VHVKSQFOQDTMNB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |