C16H11ClFN3O3 — CID 2524022
N-(2-chloro-4-fluorophenyl)-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide (PubChem CID 2524022) has the molecular formula C16H11ClFN3O3 and a molecular weight of 347.73 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 2524022 |
| Molecular Formula | C16H11ClFN3O3 |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-(1,4-dioxo-3H-phthalazin-2-yl)acetamide |
| SMILES | O=C(Cn1[nH]c(=O)c2ccccc2c1=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H11ClFN3O3/c17-12-7-9(18)5-6-13(12)19-14(22)8-21-16(24)11-4-2-1-3-10(11)15(23)20-21/h1-7H,8H2,(H,19,22)(H,20,23) |
| InChIKey | ZVQUBRPCXOGCAD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |