C17H14N4O4 — CID 18162052
4-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]benzamide (PubChem CID 18162052) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is 4-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 18162052 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C17H14N4O4/c18-15(23)10-5-7-11(8-6-10)19-14(22)9-21-17(25)13-4-2-1-3-12(13)16(24)20-21/h1-8H,9H2,(H2,18,23)(H,19,22)(H,20,24) |
| InChIKey | DHQBIKXBGJCARB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |