C23H17FN4O4 — CID 55886811
3-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]-N-(3-fluorophenyl)benzamide (PubChem CID 55886811) has the molecular formula C23H17FN4O4 and a molecular weight of 432.41 g/mol. Its IUPAC name is 3-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]-N-(3-fluorophenyl)benzamide.
| Compound Name | 3-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 55886811 |
| Molecular Formula | C23H17FN4O4 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 3-[[2-(1,4-dioxo-3H-phthalazin-2-yl)acetyl]amino]-N-(3-fluorophenyl)benzamide |
| SMILES | O=C(Cn1[nH]c(=O)c2ccccc2c1=O)Nc1cccc(C(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C23H17FN4O4/c24-15-6-4-8-17(12-15)26-21(30)14-5-3-7-16(11-14)25-20(29)13-28-23(32)19-10-2-1-9-18(19)22(31)27-28/h1-12H,13H2,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | IXKSOCSVIMRWTM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |